About 2-[(2R)-1-[[(3R)-1,1-dioxothiolan-3-yl]methyl]pyrrolidin-2-yl]-1-(4-fluorophenyl)ethanone
2-[(2R)-1-[[(3R)-1,1-dioxothiolan-3-yl]methyl]pyrrolidin-2-yl]-1-(4-fluorophenyl)ethanone (PubChem CID 124735961) has the molecular formula C17H22FNO3S
and a molecular weight of 339.43 g/mol. Its IUPAC name is 2-[(2R)-1-[[(3R)-1,1-dioxothiolan-3-yl]methyl]pyrrolidin-2-yl]-1-(4-fluorophenyl)ethanone.
Molecular Properties
| Compound Name | 2-[(2R)-1-[[(3R)-1,1-dioxothiolan-3-yl]methyl]pyrrolidin-2-yl]-1-(4-fluorophenyl)ethanone |
| PubChem CID | 124735961 |
| Molecular Formula | C17H22FNO3S |
| Molecular Weight | 339.43 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 2-[(2R)-1-[[(3R)-1,1-dioxothiolan-3-yl]methyl]pyrrolidin-2-yl]-1-(4-fluorophenyl)ethanone |
| SMILES | O=C(C[C@H]1CCCN1C[C@H]1CCS(=O)(=O)C1)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H22FNO3S/c18-15-5-3-14(4-6-15)17(20)10-16-2-1-8-19(16)11-13-7-9-23(21,22)12-13/h3-6,13,16H,1-2,7-12H2/t13-,16-/m1/s1 |
| InChIKey | OGHWHABHNQVVPN-CZUORRHYSA-N |
| XLogP | 2.30 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.43 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(2R)-1-[[(3R)-1,1-dioxothiolan-3-yl]methyl]pyrrolidin-2-yl]-1-(4-fluorophenyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2R)-1-[[(3R)-1,1-dioxothiolan-3-yl]methyl]pyrrolidin-2-yl]-1-(4-fluorophenyl)ethanone?
The IUPAC name of 2-[(2R)-1-[[(3R)-1,1-dioxothiolan-3-yl]methyl]pyrrolidin-2-yl]-1-(4-fluorophenyl)ethanone (CID 124735961) is 2-[(2R)-1-[[(3R)-1,1-dioxothiolan-3-yl]methyl]pyrrolidin-2-yl]-1-(4-fluorophenyl)ethanone.
What is the SMILES notation for 2-[(2R)-1-[[(3R)-1,1-dioxothiolan-3-yl]methyl]pyrrolidin-2-yl]-1-(4-fluorophenyl)ethanone?
The canonical SMILES for 2-[(2R)-1-[[(3R)-1,1-dioxothiolan-3-yl]methyl]pyrrolidin-2-yl]-1-(4-fluorophenyl)ethanone is O=C(C[C@H]1CCCN1C[C@H]1CCS(=O)(=O)C1)c1ccc(F)cc1.
What is the InChIKey of 2-[(2R)-1-[[(3R)-1,1-dioxothiolan-3-yl]methyl]pyrrolidin-2-yl]-1-(4-fluorophenyl)ethanone?
The InChIKey is OGHWHABHNQVVPN-CZUORRHYSA-N. The full InChI is InChI=1S/C17H22FNO3S/c18-15-5-3-14(4-6-15)17(20)10-16-2-1-8-19(16)11-13-7-9-23(21,22)12-13/h3-6,13,16H,1-2,7-12H2/t13-,16-/m1/s1.
What are the key properties of 2-[(2R)-1-[[(3R)-1,1-dioxothiolan-3-yl]methyl]pyrrolidin-2-yl]-1-(4-fluorophenyl)ethanone?
2-[(2R)-1-[[(3R)-1,1-dioxothiolan-3-yl]methyl]pyrrolidin-2-yl]-1-(4-fluorophenyl)ethanone has a molecular weight of 339.43 g/mol, XLogP of 2.30, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R)-1-[[(3R)-1,1-dioxothiolan-3-yl]methyl]pyrrolidin-2-yl]-1-(4-fluorophenyl)ethanone is sourced from PubChem (CID 124735961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).