C15H22N2O3S2 — CID 97085195
(3R)-1-(4-methylsulfanylbenzoyl)-N-propan-2-ylpyrrolidine-3-sulfonamide (PubChem CID 97085195) has the molecular formula C15H22N2O3S2 and a molecular weight of 342.49 g/mol. Its IUPAC name is (3R)-1-(4-methylsulfanylbenzoyl)-N-propan-2-ylpyrrolidine-3-sulfonamide.
| Compound Name | (3R)-1-(4-methylsulfanylbenzoyl)-N-propan-2-ylpyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 97085195 |
| Molecular Formula | C15H22N2O3S2 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | (3R)-1-(4-methylsulfanylbenzoyl)-N-propan-2-ylpyrrolidine-3-sulfonamide |
| SMILES | CSc1ccc(C(=O)N2CC[C@@H](S(=O)(=O)NC(C)C)C2)cc1 |
| InChI | InChI=1S/C15H22N2O3S2/c1-11(2)16-22(19,20)14-8-9-17(10-14)15(18)12-4-6-13(21-3)7-5-12/h4-7,11,14,16H,8-10H2,1-3H3/t14-/m1/s1 |
| InChIKey | CMQDHJWWTUHLMR-CQSZACIVSA-N |
| XLogP | 1.95 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |