C16H24N2O4S — CID 154835571
1-(5-ethyl-2-hydroxybenzoyl)-N-propan-2-ylpyrrolidine-3-sulfonamide (PubChem CID 154835571) has the molecular formula C16H24N2O4S and a molecular weight of 340.45 g/mol. Its IUPAC name is 1-(5-ethyl-2-hydroxybenzoyl)-N-propan-2-ylpyrrolidine-3-sulfonamide.
| Compound Name | 1-(5-ethyl-2-hydroxybenzoyl)-N-propan-2-ylpyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 154835571 |
| Molecular Formula | C16H24N2O4S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 1-(5-ethyl-2-hydroxybenzoyl)-N-propan-2-ylpyrrolidine-3-sulfonamide |
| SMILES | CCc1ccc(O)c(C(=O)N2CCC(S(=O)(=O)NC(C)C)C2)c1 |
| InChI | InChI=1S/C16H24N2O4S/c1-4-12-5-6-15(19)14(9-12)16(20)18-8-7-13(10-18)23(21,22)17-11(2)3/h5-6,9,11,13,17,19H,4,7-8,10H2,1-3H3 |
| InChIKey | ROMGJQHNGAOKNZ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |