C19H21FN2O4 — CID 97087035
2-(2-fluoro-4-nitrophenyl)-N-[(2S)-4-(4-methoxyphenyl)butan-2-yl]acetamide (PubChem CID 97087035) has the molecular formula C19H21FN2O4 and a molecular weight of 360.39 g/mol. Its IUPAC name is 2-(2-fluoro-4-nitrophenyl)-N-[(2S)-4-(4-methoxyphenyl)butan-2-yl]acetamide.
| Compound Name | 2-(2-fluoro-4-nitrophenyl)-N-[(2S)-4-(4-methoxyphenyl)butan-2-yl]acetamide |
|---|---|
| PubChem CID | 97087035 |
| Molecular Formula | C19H21FN2O4 |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 2-(2-fluoro-4-nitrophenyl)-N-[(2S)-4-(4-methoxyphenyl)butan-2-yl]acetamide |
| SMILES | COc1ccc(CC[C@H](C)NC(=O)Cc2ccc([N+](=O)[O-])cc2F)cc1 |
| InChI | InChI=1S/C19H21FN2O4/c1-13(3-4-14-5-9-17(26-2)10-6-14)21-19(23)11-15-7-8-16(22(24)25)12-18(15)20/h5-10,12-13H,3-4,11H2,1-2H3,(H,21,23)/t13-/m0/s1 |
| InChIKey | LZYIIJRGARULBA-ZDUSSCGKSA-N |
| XLogP | 3.42 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|