C18H24FN5O — CID 97089766
(2R)-N-[(4-fluorophenyl)methyl]-2-[[(1S)-1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]amino]propanamide (PubChem CID 97089766) has the molecular formula C18H24FN5O and a molecular weight of 345.42 g/mol. Its IUPAC name is (2R)-N-[(4-fluorophenyl)methyl]-2-[[(1S)-1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]amino]propanamide.
| Compound Name | (2R)-N-[(4-fluorophenyl)methyl]-2-[[(1S)-1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]amino]propanamide |
|---|---|
| PubChem CID | 97089766 |
| Molecular Formula | C18H24FN5O |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | (2R)-N-[(4-fluorophenyl)methyl]-2-[[(1S)-1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]amino]propanamide |
| SMILES | C[C@H](N[C@H](C)C(=O)NCc1ccc(F)cc1)c1nnc2n1CCCC2 |
| InChI | InChI=1S/C18H24FN5O/c1-12(17-23-22-16-5-3-4-10-24(16)17)21-13(2)18(25)20-11-14-6-8-15(19)9-7-14/h6-9,12-13,21H,3-5,10-11H2,1-2H3,(H,20,25)/t12-,13+/m0/s1 |
| InChIKey | IMLJVXOELPZTTO-QWHCGFSZSA-N |
| XLogP | 2.11 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |