C18H26N6O2 — CID 126776837
1-[(6-propoxy-3-pyridinyl)methyl]-3-[1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]urea (PubChem CID 126776837) has the molecular formula C18H26N6O2 and a molecular weight of 358.45 g/mol. Its IUPAC name is 1-[(6-propoxy-3-pyridinyl)methyl]-3-[1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]urea.
| Compound Name | 1-[(6-propoxy-3-pyridinyl)methyl]-3-[1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 126776837 |
| Molecular Formula | C18H26N6O2 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | 1-[(6-propoxy-3-pyridinyl)methyl]-3-[1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]urea |
| SMILES | CCCOc1ccc(CNC(=O)NC(C)c2nnc3n2CCCC3)cn1 |
| InChI | InChI=1S/C18H26N6O2/c1-3-10-26-16-8-7-14(11-19-16)12-20-18(25)21-13(2)17-23-22-15-6-4-5-9-24(15)17/h7-8,11,13H,3-6,9-10,12H2,1-2H3,(H2,20,21,25) |
| InChIKey | COOHBKHGUCZVKU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |