About 1-[(1R)-1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[(6-propoxy-3-pyridinyl)methyl]urea
1-[(1R)-1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[(6-propoxy-3-pyridinyl)methyl]urea (PubChem CID 95616355) has the molecular formula C17H25N5O2
and a molecular weight of 331.42 g/mol. Its IUPAC name is 1-[(1R)-1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[(6-propoxy-3-pyridinyl)methyl]urea.
Molecular Properties
| Compound Name | 1-[(1R)-1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[(6-propoxy-3-pyridinyl)methyl]urea |
| PubChem CID | 95616355 |
| Molecular Formula | C17H25N5O2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | 1-[(1R)-1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[(6-propoxy-3-pyridinyl)methyl]urea |
| SMILES | CCCOc1ccc(CNC(=O)N[C@H](C)c2cn(C)nc2C)cn1 |
| InChI | InChI=1S/C17H25N5O2/c1-5-8-24-16-7-6-14(9-18-16)10-19-17(23)20-12(2)15-11-22(4)21-13(15)3/h6-7,9,11-12H,5,8,10H2,1-4H3,(H2,19,20,23)/t12-/m1/s1 |
| InChIKey | MOXSTAZKUXLVGV-GFCCVEGCSA-N |
| XLogP | 2.47 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(1R)-1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[(6-propoxy-3-pyridinyl)methyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1R)-1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[(6-propoxy-3-pyridinyl)methyl]urea?
The IUPAC name of 1-[(1R)-1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[(6-propoxy-3-pyridinyl)methyl]urea (CID 95616355) is 1-[(1R)-1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[(6-propoxy-3-pyridinyl)methyl]urea.
What is the SMILES notation for 1-[(1R)-1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[(6-propoxy-3-pyridinyl)methyl]urea?
The canonical SMILES for 1-[(1R)-1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[(6-propoxy-3-pyridinyl)methyl]urea is CCCOc1ccc(CNC(=O)N[C@H](C)c2cn(C)nc2C)cn1.
What is the InChIKey of 1-[(1R)-1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[(6-propoxy-3-pyridinyl)methyl]urea?
The InChIKey is MOXSTAZKUXLVGV-GFCCVEGCSA-N. The full InChI is InChI=1S/C17H25N5O2/c1-5-8-24-16-7-6-14(9-18-16)10-19-17(23)20-12(2)15-11-22(4)21-13(15)3/h6-7,9,11-12H,5,8,10H2,1-4H3,(H2,19,20,23)/t12-/m1/s1.
What are the key properties of 1-[(1R)-1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[(6-propoxy-3-pyridinyl)methyl]urea?
1-[(1R)-1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[(6-propoxy-3-pyridinyl)methyl]urea has a molecular weight of 331.42 g/mol, XLogP of 2.47, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1R)-1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[(6-propoxy-3-pyridinyl)methyl]urea is sourced from PubChem (CID 95616355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).