C15H19N5O3 — CID 154764880
1-(1-methyl-6-oxopyridazin-3-yl)-3-[(6-propoxy-3-pyridinyl)methyl]urea (PubChem CID 154764880) has the molecular formula C15H19N5O3 and a molecular weight of 317.35 g/mol. Its IUPAC name is 1-(1-methyl-6-oxopyridazin-3-yl)-3-[(6-propoxy-3-pyridinyl)methyl]urea.
| Compound Name | 1-(1-methyl-6-oxopyridazin-3-yl)-3-[(6-propoxy-3-pyridinyl)methyl]urea |
|---|---|
| PubChem CID | 154764880 |
| Molecular Formula | C15H19N5O3 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 1-(1-methyl-6-oxopyridazin-3-yl)-3-[(6-propoxy-3-pyridinyl)methyl]urea |
| SMILES | CCCOc1ccc(CNC(=O)Nc2ccc(=O)n(C)n2)cn1 |
| InChI | InChI=1S/C15H19N5O3/c1-3-8-23-13-6-4-11(9-16-13)10-17-15(22)18-12-5-7-14(21)20(2)19-12/h4-7,9H,3,8,10H2,1-2H3,(H2,17,18,19,22) |
| InChIKey | RJPPOKBOTXAUFB-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |