C15H23N7O2 — CID 97089859
1-[(4R)-1-(2-hydroxyethyl)-4,5,6,7-tetrahydroindazol-4-yl]-3-[(1R)-1-(4-methyl-1,2,4-triazol-3-yl)ethyl]urea (PubChem CID 97089859) has the molecular formula C15H23N7O2 and a molecular weight of 333.40 g/mol. Its IUPAC name is 1-[(4R)-1-(2-hydroxyethyl)-4,5,6,7-tetrahydroindazol-4-yl]-3-[(1R)-1-(4-methyl-1,2,4-triazol-3-yl)ethyl]urea.
| Compound Name | 1-[(4R)-1-(2-hydroxyethyl)-4,5,6,7-tetrahydroindazol-4-yl]-3-[(1R)-1-(4-methyl-1,2,4-triazol-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 97089859 |
| Molecular Formula | C15H23N7O2 |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 1-[(4R)-1-(2-hydroxyethyl)-4,5,6,7-tetrahydroindazol-4-yl]-3-[(1R)-1-(4-methyl-1,2,4-triazol-3-yl)ethyl]urea |
| SMILES | C[C@@H](NC(=O)N[C@@H]1CCCc2c1cnn2CCO)c1nncn1C |
| InChI | InChI=1S/C15H23N7O2/c1-10(14-20-16-9-21(14)2)18-15(24)19-12-4-3-5-13-11(12)8-17-22(13)6-7-23/h8-10,12,23H,3-7H2,1-2H3,(H2,18,19,24)/t10-,12-/m1/s1 |
| InChIKey | WFARQRQMQQHDSC-ZYHUDNBSSA-N |
| XLogP | 0.44 |
| TPSA | 109.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |