C16H21N5O — CID 154774048
1-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]-3-(1,2,3,4-tetrahydronaphthalen-1-yl)urea (PubChem CID 154774048) has the molecular formula C16H21N5O and a molecular weight of 299.38 g/mol. Its IUPAC name is 1-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]-3-(1,2,3,4-tetrahydronaphthalen-1-yl)urea.
| Compound Name | 1-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]-3-(1,2,3,4-tetrahydronaphthalen-1-yl)urea |
|---|---|
| PubChem CID | 154774048 |
| Molecular Formula | C16H21N5O |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 1-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]-3-(1,2,3,4-tetrahydronaphthalen-1-yl)urea |
| SMILES | CC(NC(=O)NC1CCCc2ccccc21)c1nncn1C |
| InChI | InChI=1S/C16H21N5O/c1-11(15-20-17-10-21(15)2)18-16(22)19-14-9-5-7-12-6-3-4-8-13(12)14/h3-4,6,8,10-11,14H,5,7,9H2,1-2H3,(H2,18,19,22) |
| InChIKey | PNDIMPKDLRIVMK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |