C18H24FN3O3 — CID 97090048
(5S)-5-[(3R)-1-[(5-fluoro-2-methoxyphenyl)methyl]piperidin-3-yl]-3,5-dimethylimidazolidine-2,4-dione (PubChem CID 97090048) has the molecular formula C18H24FN3O3 and a molecular weight of 349.41 g/mol. Its IUPAC name is (5S)-5-[(3R)-1-[(5-fluoro-2-methoxyphenyl)methyl]piperidin-3-yl]-3,5-dimethylimidazolidine-2,4-dione.
| Compound Name | (5S)-5-[(3R)-1-[(5-fluoro-2-methoxyphenyl)methyl]piperidin-3-yl]-3,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 97090048 |
| Molecular Formula | C18H24FN3O3 |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | (5S)-5-[(3R)-1-[(5-fluoro-2-methoxyphenyl)methyl]piperidin-3-yl]-3,5-dimethylimidazolidine-2,4-dione |
| SMILES | COc1ccc(F)cc1CN1CCC[C@@H]([C@]2(C)NC(=O)N(C)C2=O)C1 |
| InChI | InChI=1S/C18H24FN3O3/c1-18(16(23)21(2)17(24)20-18)13-5-4-8-22(11-13)10-12-9-14(19)6-7-15(12)25-3/h6-7,9,13H,4-5,8,10-11H2,1-3H3,(H,20,24)/t13-,18+/m1/s1 |
| InChIKey | MTWIFQZURLUVRK-ACJLOTCBSA-N |
| XLogP | 1.99 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|