C15H28N6O — CID 97092342
1-[(2S)-2-[(2R)-2-methylpiperidin-1-yl]propyl]-3-[3-(1,2,4-triazol-1-yl)propyl]urea (PubChem CID 97092342) has the molecular formula C15H28N6O and a molecular weight of 308.43 g/mol. Its IUPAC name is 1-[(2S)-2-[(2R)-2-methylpiperidin-1-yl]propyl]-3-[3-(1,2,4-triazol-1-yl)propyl]urea.
| Compound Name | 1-[(2S)-2-[(2R)-2-methylpiperidin-1-yl]propyl]-3-[3-(1,2,4-triazol-1-yl)propyl]urea |
|---|---|
| PubChem CID | 97092342 |
| Molecular Formula | C15H28N6O |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | 1-[(2S)-2-[(2R)-2-methylpiperidin-1-yl]propyl]-3-[3-(1,2,4-triazol-1-yl)propyl]urea |
| SMILES | C[C@@H]1CCCCN1[C@@H](C)CNC(=O)NCCCn1cncn1 |
| InChI | InChI=1S/C15H28N6O/c1-13-6-3-4-9-21(13)14(2)10-18-15(22)17-7-5-8-20-12-16-11-19-20/h11-14H,3-10H2,1-2H3,(H2,17,18,22)/t13-,14+/m1/s1 |
| InChIKey | ICXJUISQXYPCLE-KGLIPLIRSA-N |
| XLogP | 1.23 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|