C17H19ClN4O2 — CID 97092982
1-[(3R)-1-acetylpyrrolidin-3-yl]-3-(4-chloro-2-pyrrol-1-ylphenyl)urea (PubChem CID 97092982) has the molecular formula C17H19ClN4O2 and a molecular weight of 346.82 g/mol. Its IUPAC name is 1-[(3R)-1-acetylpyrrolidin-3-yl]-3-(4-chloro-2-pyrrol-1-ylphenyl)urea.
| Compound Name | 1-[(3R)-1-acetylpyrrolidin-3-yl]-3-(4-chloro-2-pyrrol-1-ylphenyl)urea |
|---|---|
| PubChem CID | 97092982 |
| Molecular Formula | C17H19ClN4O2 |
| Molecular Weight | 346.82 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 1-[(3R)-1-acetylpyrrolidin-3-yl]-3-(4-chloro-2-pyrrol-1-ylphenyl)urea |
| SMILES | CC(=O)N1CC[C@@H](NC(=O)Nc2ccc(Cl)cc2-n2cccc2)C1 |
| InChI | InChI=1S/C17H19ClN4O2/c1-12(23)22-9-6-14(11-22)19-17(24)20-15-5-4-13(18)10-16(15)21-7-2-3-8-21/h2-5,7-8,10,14H,6,9,11H2,1H3,(H2,19,20,24)/t14-/m1/s1 |
| InChIKey | IBTKRUJFTISOCH-CQSZACIVSA-N |
| XLogP | 2.87 |
| TPSA | 66.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.82 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |