C16H20ClN3O2 — CID 111474823
1-(4-chloro-2-pyrrol-1-ylphenyl)-3-(4-hydroxy-2-methylbutyl)urea (PubChem CID 111474823) has the molecular formula C16H20ClN3O2 and a molecular weight of 321.81 g/mol. Its IUPAC name is 1-(4-chloro-2-pyrrol-1-ylphenyl)-3-(4-hydroxy-2-methylbutyl)urea.
| Compound Name | 1-(4-chloro-2-pyrrol-1-ylphenyl)-3-(4-hydroxy-2-methylbutyl)urea |
|---|---|
| PubChem CID | 111474823 |
| Molecular Formula | C16H20ClN3O2 |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 1-(4-chloro-2-pyrrol-1-ylphenyl)-3-(4-hydroxy-2-methylbutyl)urea |
| SMILES | CC(CCO)CNC(=O)Nc1ccc(Cl)cc1-n1cccc1 |
| InChI | InChI=1S/C16H20ClN3O2/c1-12(6-9-21)11-18-16(22)19-14-5-4-13(17)10-15(14)20-7-2-3-8-20/h2-5,7-8,10,12,21H,6,9,11H2,1H3,(H2,18,19,22) |
| InChIKey | IPGFONXPCJGXNS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |