C13H27N3O2 — CID 97095456
(3R)-3-(2-methylbutan-2-ylcarbamoylamino)-N-propan-2-ylbutanamide (PubChem CID 97095456) has the molecular formula C13H27N3O2 and a molecular weight of 257.38 g/mol. Its IUPAC name is (3R)-3-(2-methylbutan-2-ylcarbamoylamino)-N-propan-2-ylbutanamide.
| Compound Name | (3R)-3-(2-methylbutan-2-ylcarbamoylamino)-N-propan-2-ylbutanamide |
|---|---|
| PubChem CID | 97095456 |
| Molecular Formula | C13H27N3O2 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | (3R)-3-(2-methylbutan-2-ylcarbamoylamino)-N-propan-2-ylbutanamide |
| SMILES | CCC(C)(C)NC(=O)N[C@H](C)CC(=O)NC(C)C |
| InChI | InChI=1S/C13H27N3O2/c1-7-13(5,6)16-12(18)15-10(4)8-11(17)14-9(2)3/h9-10H,7-8H2,1-6H3,(H,14,17)(H2,15,16,18)/t10-/m1/s1 |
| InChIKey | PEMPRUJJNVCMPH-SNVBAGLBSA-N |
| XLogP | 1.78 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |