C12H17BrN2O2S — CID 97097732
(2S)-N-[(5-bromothiophen-3-yl)methyl]-2-ethylmorpholine-4-carboxamide (PubChem CID 97097732) has the molecular formula C12H17BrN2O2S and a molecular weight of 333.25 g/mol. Its IUPAC name is (2S)-N-[(5-bromothiophen-3-yl)methyl]-2-ethylmorpholine-4-carboxamide.
| Compound Name | (2S)-N-[(5-bromothiophen-3-yl)methyl]-2-ethylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 97097732 |
| Molecular Formula | C12H17BrN2O2S |
| Molecular Weight | 333.25 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | (2S)-N-[(5-bromothiophen-3-yl)methyl]-2-ethylmorpholine-4-carboxamide |
| SMILES | CC[C@H]1CN(C(=O)NCc2csc(Br)c2)CCO1 |
| InChI | InChI=1S/C12H17BrN2O2S/c1-2-10-7-15(3-4-17-10)12(16)14-6-9-5-11(13)18-8-9/h5,8,10H,2-4,6-7H2,1H3,(H,14,16)/t10-/m0/s1 |
| InChIKey | NPTUUKORSMIDAS-JTQLQIEISA-N |
| XLogP | 2.83 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.25 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |