C12H19N5O4 — CID 115458536
2-[4-[[(2-ethylmorpholine-4-carbonyl)amino]methyl]triazol-1-yl]acetic acid (PubChem CID 115458536) has the molecular formula C12H19N5O4 and a molecular weight of 297.32 g/mol. Its IUPAC name is 2-[4-[[(2-ethylmorpholine-4-carbonyl)amino]methyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[[(2-ethylmorpholine-4-carbonyl)amino]methyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 115458536 |
| Molecular Formula | C12H19N5O4 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 2-[4-[[(2-ethylmorpholine-4-carbonyl)amino]methyl]triazol-1-yl]acetic acid |
| SMILES | CCC1CN(C(=O)NCc2cn(CC(=O)O)nn2)CCO1 |
| InChI | InChI=1S/C12H19N5O4/c1-2-10-7-16(3-4-21-10)12(20)13-5-9-6-17(15-14-9)8-11(18)19/h6,10H,2-5,7-8H2,1H3,(H,13,20)(H,18,19) |
| InChIKey | GWZFPIJQWAHWTF-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |