C11H15N5O3 — CID 114411536
2-[4-[(3,6-dihydro-2H-pyridine-1-carbonylamino)methyl]triazol-1-yl]acetic acid (PubChem CID 114411536) has the molecular formula C11H15N5O3 and a molecular weight of 265.27 g/mol. Its IUPAC name is 2-[4-[(3,6-dihydro-2H-pyridine-1-carbonylamino)methyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[(3,6-dihydro-2H-pyridine-1-carbonylamino)methyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 114411536 |
| Molecular Formula | C11H15N5O3 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 2-[4-[(3,6-dihydro-2H-pyridine-1-carbonylamino)methyl]triazol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1cc(CNC(=O)N2CC=CCC2)nn1 |
| InChI | InChI=1S/C11H15N5O3/c17-10(18)8-16-7-9(13-14-16)6-12-11(19)15-4-2-1-3-5-15/h1-2,7H,3-6,8H2,(H,12,19)(H,17,18) |
| InChIKey | GEXOMNZZYWWGTD-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|