C10H14N6O4 — CID 115458456
2-[4-[[(3-oxopiperazine-1-carbonyl)amino]methyl]triazol-1-yl]acetic acid (PubChem CID 115458456) has the molecular formula C10H14N6O4 and a molecular weight of 282.26 g/mol. Its IUPAC name is 2-[4-[[(3-oxopiperazine-1-carbonyl)amino]methyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[[(3-oxopiperazine-1-carbonyl)amino]methyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 115458456 |
| Molecular Formula | C10H14N6O4 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 2-[4-[[(3-oxopiperazine-1-carbonyl)amino]methyl]triazol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1cc(CNC(=O)N2CCNC(=O)C2)nn1 |
| InChI | InChI=1S/C10H14N6O4/c17-8-5-15(2-1-11-8)10(20)12-3-7-4-16(14-13-7)6-9(18)19/h4H,1-3,5-6H2,(H,11,17)(H,12,20)(H,18,19) |
| InChIKey | HZTLMYISEOMGEX-UHFFFAOYSA-N |
| XLogP | -2.00 |
| TPSA | 129.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |