C9H11N5O4 — CID 66288894
1-[2-oxo-2-(3-oxopiperazin-1-yl)ethyl]triazole-4-carboxylic acid (PubChem CID 66288894) has the molecular formula C9H11N5O4 and a molecular weight of 253.22 g/mol. Its IUPAC name is 1-[2-oxo-2-(3-oxopiperazin-1-yl)ethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-oxo-2-(3-oxopiperazin-1-yl)ethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 66288894 |
| Molecular Formula | C9H11N5O4 |
| Molecular Weight | 253.22 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | 1-[2-oxo-2-(3-oxopiperazin-1-yl)ethyl]triazole-4-carboxylic acid |
| SMILES | O=C1CN(C(=O)Cn2cc(C(=O)O)nn2)CCN1 |
| InChI | InChI=1S/C9H11N5O4/c15-7-4-13(2-1-10-7)8(16)5-14-3-6(9(17)18)11-12-14/h3H,1-2,4-5H2,(H,10,15)(H,17,18) |
| InChIKey | RQZLNTPTISJSSR-UHFFFAOYSA-N |
| XLogP | -2.07 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.22 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |