C12H19N5O3 — CID 66289138
1-[2-(4-ethyl-3-methylpiperazin-1-yl)-2-oxoethyl]triazole-4-carboxylic acid (PubChem CID 66289138) has the molecular formula C12H19N5O3 and a molecular weight of 281.32 g/mol. Its IUPAC name is 1-[2-(4-ethyl-3-methylpiperazin-1-yl)-2-oxoethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-(4-ethyl-3-methylpiperazin-1-yl)-2-oxoethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 66289138 |
| Molecular Formula | C12H19N5O3 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 1-[2-(4-ethyl-3-methylpiperazin-1-yl)-2-oxoethyl]triazole-4-carboxylic acid |
| SMILES | CCN1CCN(C(=O)Cn2cc(C(=O)O)nn2)CC1C |
| InChI | InChI=1S/C12H19N5O3/c1-3-15-4-5-16(6-9(15)2)11(18)8-17-7-10(12(19)20)13-14-17/h7,9H,3-6,8H2,1-2H3,(H,19,20) |
| InChIKey | HGBZWPHJIKKGMZ-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |