C15H22BrN3O2 — CID 97097882
(2S)-N-[2-(4-bromoanilino)-2-oxoethyl]-2-(dimethylamino)pentanamide (PubChem CID 97097882) has the molecular formula C15H22BrN3O2 and a molecular weight of 356.26 g/mol. Its IUPAC name is (2S)-N-[2-(4-bromoanilino)-2-oxoethyl]-2-(dimethylamino)pentanamide.
| Compound Name | (2S)-N-[2-(4-bromoanilino)-2-oxoethyl]-2-(dimethylamino)pentanamide |
|---|---|
| PubChem CID | 97097882 |
| Molecular Formula | C15H22BrN3O2 |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | (2S)-N-[2-(4-bromoanilino)-2-oxoethyl]-2-(dimethylamino)pentanamide |
| SMILES | CCC[C@@H](C(=O)NCC(=O)Nc1ccc(Br)cc1)N(C)C |
| InChI | InChI=1S/C15H22BrN3O2/c1-4-5-13(19(2)3)15(21)17-10-14(20)18-12-8-6-11(16)7-9-12/h6-9,13H,4-5,10H2,1-3H3,(H,17,21)(H,18,20)/t13-/m0/s1 |
| InChIKey | LLDGKJRIGAPSOR-ZDUSSCGKSA-N |
| XLogP | 2.23 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |