C17H25NO4S — CID 97098338
2-[(S)-(5-acetyl-2-methoxyphenyl)methylsulfinyl]-N-pentylacetamide (PubChem CID 97098338) has the molecular formula C17H25NO4S and a molecular weight of 339.46 g/mol. Its IUPAC name is 2-[(S)-(5-acetyl-2-methoxyphenyl)methylsulfinyl]-N-pentylacetamide.
| Compound Name | 2-[(S)-(5-acetyl-2-methoxyphenyl)methylsulfinyl]-N-pentylacetamide |
|---|---|
| PubChem CID | 97098338 |
| Molecular Formula | C17H25NO4S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 2-[(S)-(5-acetyl-2-methoxyphenyl)methylsulfinyl]-N-pentylacetamide |
| SMILES | CCCCCNC(=O)C[S@@](=O)Cc1cc(C(C)=O)ccc1OC |
| InChI | InChI=1S/C17H25NO4S/c1-4-5-6-9-18-17(20)12-23(21)11-15-10-14(13(2)19)7-8-16(15)22-3/h7-8,10H,4-6,9,11-12H2,1-3H3,(H,18,20)/t23-/m0/s1 |
| InChIKey | MJPZIOMCBFMEHX-QHCPKHFHSA-N |
| XLogP | 2.45 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|