C14H20N2OS — CID 97101620
1-[(3R)-3-(4-but-3-enyl-1,3-thiazol-2-yl)piperidin-1-yl]ethanone (PubChem CID 97101620) has the molecular formula C14H20N2OS and a molecular weight of 264.39 g/mol. Its IUPAC name is 1-[(3R)-3-(4-but-3-enyl-1,3-thiazol-2-yl)piperidin-1-yl]ethanone.
| Compound Name | 1-[(3R)-3-(4-but-3-enyl-1,3-thiazol-2-yl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 97101620 |
| Molecular Formula | C14H20N2OS |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 1-[(3R)-3-(4-but-3-enyl-1,3-thiazol-2-yl)piperidin-1-yl]ethanone |
| SMILES | C=CCCc1csc([C@@H]2CCCN(C(C)=O)C2)n1 |
| InChI | InChI=1S/C14H20N2OS/c1-3-4-7-13-10-18-14(15-13)12-6-5-8-16(9-12)11(2)17/h3,10,12H,1,4-9H2,2H3/t12-/m1/s1 |
| InChIKey | GNHMTHLLJHZVIU-GFCCVEGCSA-N |
| XLogP | 2.99 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|