C17H28N2O2S — CID 97105367
[(1S)-cyclohex-3-en-1-yl]-[(3R)-3-(morpholin-4-ylmethyl)-1,4-thiazepan-4-yl]methanone (PubChem CID 97105367) has the molecular formula C17H28N2O2S and a molecular weight of 324.49 g/mol. Its IUPAC name is [(1S)-cyclohex-3-en-1-yl]-[(3R)-3-(morpholin-4-ylmethyl)-1,4-thiazepan-4-yl]methanone.
| Compound Name | [(1S)-cyclohex-3-en-1-yl]-[(3R)-3-(morpholin-4-ylmethyl)-1,4-thiazepan-4-yl]methanone |
|---|---|
| PubChem CID | 97105367 |
| Molecular Formula | C17H28N2O2S |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | [(1S)-cyclohex-3-en-1-yl]-[(3R)-3-(morpholin-4-ylmethyl)-1,4-thiazepan-4-yl]methanone |
| SMILES | O=C([C@@H]1CC=CCC1)N1CCCSC[C@H]1CN1CCOCC1 |
| InChI | InChI=1S/C17H28N2O2S/c20-17(15-5-2-1-3-6-15)19-7-4-12-22-14-16(19)13-18-8-10-21-11-9-18/h1-2,15-16H,3-14H2/t15-,16-/m1/s1 |
| InChIKey | IFMKHKSHBZIVMC-HZPDHXFCSA-N |
| XLogP | 2.01 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|