C15H21FN2O3 — CID 97108242
(3R)-N-(4-fluorophenyl)-3-[[(3S)-3-hydroxyoxolan-3-yl]methylamino]butanamide (PubChem CID 97108242) has the molecular formula C15H21FN2O3 and a molecular weight of 296.34 g/mol. Its IUPAC name is (3R)-N-(4-fluorophenyl)-3-[[(3S)-3-hydroxyoxolan-3-yl]methylamino]butanamide.
| Compound Name | (3R)-N-(4-fluorophenyl)-3-[[(3S)-3-hydroxyoxolan-3-yl]methylamino]butanamide |
|---|---|
| PubChem CID | 97108242 |
| Molecular Formula | C15H21FN2O3 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | (3R)-N-(4-fluorophenyl)-3-[[(3S)-3-hydroxyoxolan-3-yl]methylamino]butanamide |
| SMILES | C[C@H](CC(=O)Nc1ccc(F)cc1)NC[C@@]1(O)CCOC1 |
| InChI | InChI=1S/C15H21FN2O3/c1-11(17-9-15(20)6-7-21-10-15)8-14(19)18-13-4-2-12(16)3-5-13/h2-5,11,17,20H,6-10H2,1H3,(H,18,19)/t11-,15+/m1/s1 |
| InChIKey | WNKPCQCMIMSDMB-ABAIWWIYSA-N |
| XLogP | 1.28 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |