C13H18N2O4 — CID 103847569
1-[(3-hydroxyoxolan-3-yl)methyl]-3-(4-methoxyphenyl)urea (PubChem CID 103847569) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is 1-[(3-hydroxyoxolan-3-yl)methyl]-3-(4-methoxyphenyl)urea.
| Compound Name | 1-[(3-hydroxyoxolan-3-yl)methyl]-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 103847569 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 1-[(3-hydroxyoxolan-3-yl)methyl]-3-(4-methoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)NCC2(O)CCOC2)cc1 |
| InChI | InChI=1S/C13H18N2O4/c1-18-11-4-2-10(3-5-11)15-12(16)14-8-13(17)6-7-19-9-13/h2-5,17H,6-9H2,1H3,(H2,14,15,16) |
| InChIKey | ISOWIEKIKWPIPW-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |