C14H20N2O3 — CID 129397875
1-(3,4-dimethylphenyl)-3-[[(3S)-3-hydroxyoxolan-3-yl]methyl]urea (PubChem CID 129397875) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-3-[[(3S)-3-hydroxyoxolan-3-yl]methyl]urea.
| Compound Name | 1-(3,4-dimethylphenyl)-3-[[(3S)-3-hydroxyoxolan-3-yl]methyl]urea |
|---|---|
| PubChem CID | 129397875 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-3-[[(3S)-3-hydroxyoxolan-3-yl]methyl]urea |
| SMILES | Cc1ccc(NC(=O)NC[C@@]2(O)CCOC2)cc1C |
| InChI | InChI=1S/C14H20N2O3/c1-10-3-4-12(7-11(10)2)16-13(17)15-8-14(18)5-6-19-9-14/h3-4,7,18H,5-6,8-9H2,1-2H3,(H2,15,16,17)/t14-/m0/s1 |
| InChIKey | HYCNALKQWZGFER-AWEZNQCLSA-N |
| XLogP | 1.58 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |