C10H17F2NS — CID 97112278
(4R,5S)-4-(difluoromethyl)-1-thia-9-azaspiro[4.6]undecane (PubChem CID 97112278) has the molecular formula C10H17F2NS and a molecular weight of 221.32 g/mol. Its IUPAC name is (4R,5S)-4-(difluoromethyl)-1-thia-9-azaspiro[4.6]undecane.
| Compound Name | (4R,5S)-4-(difluoromethyl)-1-thia-9-azaspiro[4.6]undecane |
|---|---|
| PubChem CID | 97112278 |
| Molecular Formula | C10H17F2NS |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | (4R,5S)-4-(difluoromethyl)-1-thia-9-azaspiro[4.6]undecane |
| SMILES | FC(F)[C@H]1CCS[C@]12CCCNCC2 |
| InChI | InChI=1S/C10H17F2NS/c11-9(12)8-2-7-14-10(8)3-1-5-13-6-4-10/h8-9,13H,1-7H2/t8-,10+/m1/s1 |
| InChIKey | QQVDGRLQNQOCIN-SCZZXKLOSA-N |
| XLogP | 2.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |