C17H20F3NO3 — CID 97113303
(3R)-3-ethyl-1-[2-[2-(trifluoromethyl)phenyl]acetyl]piperidine-3-carboxylic acid (PubChem CID 97113303) has the molecular formula C17H20F3NO3 and a molecular weight of 343.34 g/mol. Its IUPAC name is (3R)-3-ethyl-1-[2-[2-(trifluoromethyl)phenyl]acetyl]piperidine-3-carboxylic acid.
| Compound Name | (3R)-3-ethyl-1-[2-[2-(trifluoromethyl)phenyl]acetyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 97113303 |
| Molecular Formula | C17H20F3NO3 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | (3R)-3-ethyl-1-[2-[2-(trifluoromethyl)phenyl]acetyl]piperidine-3-carboxylic acid |
| SMILES | CC[C@@]1(C(=O)O)CCCN(C(=O)Cc2ccccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C17H20F3NO3/c1-2-16(15(23)24)8-5-9-21(11-16)14(22)10-12-6-3-4-7-13(12)17(18,19)20/h3-4,6-7H,2,5,8-11H2,1H3,(H,23,24)/t16-/m1/s1 |
| InChIKey | HZUPVDPYGAEOKC-MRXNPFEDSA-N |
| XLogP | 3.35 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |