C17H20F3NO2 — CID 97145730
1-[(5R)-2-oxa-9-azaspiro[4.5]decan-9-yl]-2-[2-(trifluoromethyl)phenyl]ethanone (PubChem CID 97145730) has the molecular formula C17H20F3NO2 and a molecular weight of 327.35 g/mol. Its IUPAC name is 1-[(5R)-2-oxa-9-azaspiro[4.5]decan-9-yl]-2-[2-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 1-[(5R)-2-oxa-9-azaspiro[4.5]decan-9-yl]-2-[2-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 97145730 |
| Molecular Formula | C17H20F3NO2 |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 1-[(5R)-2-oxa-9-azaspiro[4.5]decan-9-yl]-2-[2-(trifluoromethyl)phenyl]ethanone |
| SMILES | O=C(Cc1ccccc1C(F)(F)F)N1CCC[C@@]2(CCOC2)C1 |
| InChI | InChI=1S/C17H20F3NO2/c18-17(19,20)14-5-2-1-4-13(14)10-15(22)21-8-3-6-16(11-21)7-9-23-12-16/h1-2,4-5H,3,6-12H2/t16-/m1/s1 |
| InChIKey | RPIOFOURZOHXBF-MRXNPFEDSA-N |
| XLogP | 3.28 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |