About (3R)-3-chloro-3,5-difluoro-2H-pyridine
(3R)-3-chloro-3,5-difluoro-2H-pyridine (PubChem CID 97114946) has the molecular formula C5H4ClF2N
and a molecular weight of 151.54 g/mol. Its IUPAC name is (3R)-3-chloro-3,5-difluoro-2H-pyridine.
Molecular Properties
| Compound Name | (3R)-3-chloro-3,5-difluoro-2H-pyridine |
| PubChem CID | 97114946 |
| Molecular Formula | C5H4ClF2N |
| Molecular Weight | 151.54 g/mol |
| Exact Mass | 151.00 |
| IUPAC Name | (3R)-3-chloro-3,5-difluoro-2H-pyridine |
| SMILES | FC1=C[C@@](F)(Cl)CN=C1 |
| InChI | InChI=1S/C5H4ClF2N/c6-5(8)1-4(7)2-9-3-5/h1-2H,3H2/t5-/m0/s1 |
| InChIKey | UPBXKDQPRDCHMR-YFKPBYRVSA-N |
| XLogP | 1.83 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.54 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-chloro-3,5-difluoro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-chloro-3,5-difluoro-2H-pyridine?
The IUPAC name of (3R)-3-chloro-3,5-difluoro-2H-pyridine (CID 97114946) is (3R)-3-chloro-3,5-difluoro-2H-pyridine.
What is the SMILES notation for (3R)-3-chloro-3,5-difluoro-2H-pyridine?
The canonical SMILES for (3R)-3-chloro-3,5-difluoro-2H-pyridine is FC1=C[C@@](F)(Cl)CN=C1.
What is the InChIKey of (3R)-3-chloro-3,5-difluoro-2H-pyridine?
The InChIKey is UPBXKDQPRDCHMR-YFKPBYRVSA-N. The full InChI is InChI=1S/C5H4ClF2N/c6-5(8)1-4(7)2-9-3-5/h1-2H,3H2/t5-/m0/s1.
What are the key properties of (3R)-3-chloro-3,5-difluoro-2H-pyridine?
(3R)-3-chloro-3,5-difluoro-2H-pyridine has a molecular weight of 151.54 g/mol, XLogP of 1.83, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-chloro-3,5-difluoro-2H-pyridine is sourced from PubChem (CID 97114946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).