C21H22N2O2 — CID 97117703
(2R)-2-naphthalen-2-yloxy-N-(3-pyridin-2-ylpropyl)propanamide (PubChem CID 97117703) has the molecular formula C21H22N2O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is (2R)-2-naphthalen-2-yloxy-N-(3-pyridin-2-ylpropyl)propanamide.
| Compound Name | (2R)-2-naphthalen-2-yloxy-N-(3-pyridin-2-ylpropyl)propanamide |
|---|---|
| PubChem CID | 97117703 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | (2R)-2-naphthalen-2-yloxy-N-(3-pyridin-2-ylpropyl)propanamide |
| SMILES | C[C@@H](Oc1ccc2ccccc2c1)C(=O)NCCCc1ccccn1 |
| InChI | InChI=1S/C21H22N2O2/c1-16(21(24)23-14-6-10-19-9-4-5-13-22-19)25-20-12-11-17-7-2-3-8-18(17)15-20/h2-5,7-9,11-13,15-16H,6,10,14H2,1H3,(H,23,24)/t16-/m1/s1 |
| InChIKey | MNFHTCUTDGBFLE-MRXNPFEDSA-N |
| XLogP | 3.75 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|