C16H23N3O2 — CID 97119136
(3R)-1-[(2-amino-3-pyridinyl)methyl]-3-(cyclopropylmethyl)piperidine-3-carboxylic acid (PubChem CID 97119136) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is (3R)-1-[(2-amino-3-pyridinyl)methyl]-3-(cyclopropylmethyl)piperidine-3-carboxylic acid.
| Compound Name | (3R)-1-[(2-amino-3-pyridinyl)methyl]-3-(cyclopropylmethyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 97119136 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | (3R)-1-[(2-amino-3-pyridinyl)methyl]-3-(cyclopropylmethyl)piperidine-3-carboxylic acid |
| SMILES | Nc1ncccc1CN1CCC[C@](CC2CC2)(C(=O)O)C1 |
| InChI | InChI=1S/C16H23N3O2/c17-14-13(3-1-7-18-14)10-19-8-2-6-16(11-19,15(20)21)9-12-4-5-12/h1,3,7,12H,2,4-6,8-11H2,(H2,17,18)(H,20,21)/t16-/m1/s1 |
| InChIKey | SLEHEXMVKHYNND-MRXNPFEDSA-N |
| XLogP | 2.13 |
| TPSA | 79.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |