C17H24N4O2 — CID 97120709
1-[2-oxo-2-[(2S)-2-pyridin-2-ylpyrrolidin-1-yl]ethyl]piperidine-4-carboxamide (PubChem CID 97120709) has the molecular formula C17H24N4O2 and a molecular weight of 316.40 g/mol. Its IUPAC name is 1-[2-oxo-2-[(2S)-2-pyridin-2-ylpyrrolidin-1-yl]ethyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-oxo-2-[(2S)-2-pyridin-2-ylpyrrolidin-1-yl]ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 97120709 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 1-[2-oxo-2-[(2S)-2-pyridin-2-ylpyrrolidin-1-yl]ethyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(CC(=O)N2CCC[C@H]2c2ccccn2)CC1 |
| InChI | InChI=1S/C17H24N4O2/c18-17(23)13-6-10-20(11-7-13)12-16(22)21-9-3-5-15(21)14-4-1-2-8-19-14/h1-2,4,8,13,15H,3,5-7,9-12H2,(H2,18,23)/t15-/m0/s1 |
| InChIKey | RXEOJOCHBVZUST-HNNXBMFYSA-N |
| XLogP | 0.94 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |