C21H29N3O — CID 97122706
[3-[(2S)-2-methylpiperidin-1-yl]azetidin-1-yl]-(3,5,7-trimethyl-1H-indol-2-yl)methanone (PubChem CID 97122706) has the molecular formula C21H29N3O and a molecular weight of 339.48 g/mol. Its IUPAC name is [3-[(2S)-2-methylpiperidin-1-yl]azetidin-1-yl]-(3,5,7-trimethyl-1H-indol-2-yl)methanone.
| Compound Name | [3-[(2S)-2-methylpiperidin-1-yl]azetidin-1-yl]-(3,5,7-trimethyl-1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 97122706 |
| Molecular Formula | C21H29N3O |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.23 |
| IUPAC Name | [3-[(2S)-2-methylpiperidin-1-yl]azetidin-1-yl]-(3,5,7-trimethyl-1H-indol-2-yl)methanone |
| SMILES | Cc1cc(C)c2[nH]c(C(=O)N3CC(N4CCCC[C@@H]4C)C3)c(C)c2c1 |
| InChI | InChI=1S/C21H29N3O/c1-13-9-14(2)19-18(10-13)16(4)20(22-19)21(25)23-11-17(12-23)24-8-6-5-7-15(24)3/h9-10,15,17,22H,5-8,11-12H2,1-4H3/t15-/m0/s1 |
| InChIKey | QDIDDJRPXVPRED-HNNXBMFYSA-N |
| XLogP | 3.79 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|