C19H27N3O — CID 72927870
[(3R,4S)-3-amino-4-propylpyrrolidin-1-yl]-(3,5,7-trimethyl-1H-indol-2-yl)methanone (PubChem CID 72927870) has the molecular formula C19H27N3O and a molecular weight of 313.44 g/mol. Its IUPAC name is [(3R,4S)-3-amino-4-propylpyrrolidin-1-yl]-(3,5,7-trimethyl-1H-indol-2-yl)methanone.
| Compound Name | [(3R,4S)-3-amino-4-propylpyrrolidin-1-yl]-(3,5,7-trimethyl-1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 72927870 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | [(3R,4S)-3-amino-4-propylpyrrolidin-1-yl]-(3,5,7-trimethyl-1H-indol-2-yl)methanone |
| SMILES | CCC[C@H]1CN(C(=O)c2[nH]c3c(C)cc(C)cc3c2C)C[C@@H]1N |
| InChI | InChI=1S/C19H27N3O/c1-5-6-14-9-22(10-16(14)20)19(23)18-13(4)15-8-11(2)7-12(3)17(15)21-18/h7-8,14,16,21H,5-6,9-10,20H2,1-4H3/t14-,16-/m0/s1 |
| InChIKey | ABQBVVJGPPFGFO-HOCLYGCPSA-N |
| XLogP | 3.29 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|