About N-ethyl-3,5,7-trimethyl-N-[[(2R)-oxan-2-yl]methyl]-1H-indole-2-carboxamide
N-ethyl-3,5,7-trimethyl-N-[[(2R)-oxan-2-yl]methyl]-1H-indole-2-carboxamide (PubChem CID 97114573) has the molecular formula C20H28N2O2
and a molecular weight of 328.46 g/mol. Its IUPAC name is N-ethyl-3,5,7-trimethyl-N-[[(2R)-oxan-2-yl]methyl]-1H-indole-2-carboxamide.
Molecular Properties
| Compound Name | N-ethyl-3,5,7-trimethyl-N-[[(2R)-oxan-2-yl]methyl]-1H-indole-2-carboxamide |
| PubChem CID | 97114573 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | N-ethyl-3,5,7-trimethyl-N-[[(2R)-oxan-2-yl]methyl]-1H-indole-2-carboxamide |
| SMILES | CCN(C[C@H]1CCCCO1)C(=O)c1[nH]c2c(C)cc(C)cc2c1C |
| InChI | InChI=1S/C20H28N2O2/c1-5-22(12-16-8-6-7-9-24-16)20(23)19-15(4)17-11-13(2)10-14(3)18(17)21-19/h10-11,16,21H,5-9,12H2,1-4H3/t16-/m1/s1 |
| InChIKey | DJNGQUMLTXIYNG-MRXNPFEDSA-N |
| XLogP | 4.12 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-3,5,7-trimethyl-N-[[(2R)-oxan-2-yl]methyl]-1H-indole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-3,5,7-trimethyl-N-[[(2R)-oxan-2-yl]methyl]-1H-indole-2-carboxamide?
The IUPAC name of N-ethyl-3,5,7-trimethyl-N-[[(2R)-oxan-2-yl]methyl]-1H-indole-2-carboxamide (CID 97114573) is N-ethyl-3,5,7-trimethyl-N-[[(2R)-oxan-2-yl]methyl]-1H-indole-2-carboxamide.
What is the SMILES notation for N-ethyl-3,5,7-trimethyl-N-[[(2R)-oxan-2-yl]methyl]-1H-indole-2-carboxamide?
The canonical SMILES for N-ethyl-3,5,7-trimethyl-N-[[(2R)-oxan-2-yl]methyl]-1H-indole-2-carboxamide is CCN(C[C@H]1CCCCO1)C(=O)c1[nH]c2c(C)cc(C)cc2c1C.
What is the InChIKey of N-ethyl-3,5,7-trimethyl-N-[[(2R)-oxan-2-yl]methyl]-1H-indole-2-carboxamide?
The InChIKey is DJNGQUMLTXIYNG-MRXNPFEDSA-N. The full InChI is InChI=1S/C20H28N2O2/c1-5-22(12-16-8-6-7-9-24-16)20(23)19-15(4)17-11-13(2)10-14(3)18(17)21-19/h10-11,16,21H,5-9,12H2,1-4H3/t16-/m1/s1.
What are the key properties of N-ethyl-3,5,7-trimethyl-N-[[(2R)-oxan-2-yl]methyl]-1H-indole-2-carboxamide?
N-ethyl-3,5,7-trimethyl-N-[[(2R)-oxan-2-yl]methyl]-1H-indole-2-carboxamide has a molecular weight of 328.46 g/mol, XLogP of 4.12, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-3,5,7-trimethyl-N-[[(2R)-oxan-2-yl]methyl]-1H-indole-2-carboxamide is sourced from PubChem (CID 97114573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).