C19H26N2O2 — CID 125169183
N,1-diethyl-N-[[(2R)-oxan-2-yl]methyl]indole-5-carboxamide (PubChem CID 125169183) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is N,1-diethyl-N-[[(2R)-oxan-2-yl]methyl]indole-5-carboxamide.
| Compound Name | N,1-diethyl-N-[[(2R)-oxan-2-yl]methyl]indole-5-carboxamide |
|---|---|
| PubChem CID | 125169183 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | N,1-diethyl-N-[[(2R)-oxan-2-yl]methyl]indole-5-carboxamide |
| SMILES | CCN(C[C@H]1CCCCO1)C(=O)c1ccc2c(ccn2CC)c1 |
| InChI | InChI=1S/C19H26N2O2/c1-3-20-11-10-15-13-16(8-9-18(15)20)19(22)21(4-2)14-17-7-5-6-12-23-17/h8-11,13,17H,3-7,12,14H2,1-2H3/t17-/m1/s1 |
| InChIKey | UJENMJMOGWDNAZ-QGZVFWFLSA-N |
| XLogP | 3.69 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |