C22H27N3O3 — CID 97125961
(5R)-5-(1,3-benzodioxol-5-ylmethyl)-5-methyl-1-[3-(pyridin-3-ylamino)propyl]piperidin-2-one (PubChem CID 97125961) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is (5R)-5-(1,3-benzodioxol-5-ylmethyl)-5-methyl-1-[3-(pyridin-3-ylamino)propyl]piperidin-2-one.
| Compound Name | (5R)-5-(1,3-benzodioxol-5-ylmethyl)-5-methyl-1-[3-(pyridin-3-ylamino)propyl]piperidin-2-one |
|---|---|
| PubChem CID | 97125961 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | (5R)-5-(1,3-benzodioxol-5-ylmethyl)-5-methyl-1-[3-(pyridin-3-ylamino)propyl]piperidin-2-one |
| SMILES | C[C@]1(Cc2ccc3c(c2)OCO3)CCC(=O)N(CCCNc2cccnc2)C1 |
| InChI | InChI=1S/C22H27N3O3/c1-22(13-17-5-6-19-20(12-17)28-16-27-19)8-7-21(26)25(15-22)11-3-10-24-18-4-2-9-23-14-18/h2,4-6,9,12,14,24H,3,7-8,10-11,13,15-16H2,1H3/t22-/m1/s1 |
| InChIKey | AZGVMUSISDUKKL-JOCHJYFZSA-N |
| XLogP | 3.48 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|