C17H28Cl2N4O — CID 154925020
2-[3-(pyridin-3-ylamino)propyl]-2,9-diazaspiro[5.5]undecan-3-one;dihydrochloride (PubChem CID 154925020) has the molecular formula C17H28Cl2N4O and a molecular weight of 375.34 g/mol. Its IUPAC name is 2-[3-(pyridin-3-ylamino)propyl]-2,9-diazaspiro[5.5]undecan-3-one;dihydrochloride.
| Compound Name | 2-[3-(pyridin-3-ylamino)propyl]-2,9-diazaspiro[5.5]undecan-3-one;dihydrochloride |
|---|---|
| PubChem CID | 154925020 |
| Molecular Formula | C17H28Cl2N4O |
| Molecular Weight | 375.34 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 2-[3-(pyridin-3-ylamino)propyl]-2,9-diazaspiro[5.5]undecan-3-one;dihydrochloride |
| SMILES | Cl.Cl.O=C1CCC2(CCNCC2)CN1CCCNc1cccnc1 |
| InChI | InChI=1S/C17H26N4O.2ClH/c22-16-4-5-17(6-10-18-11-7-17)14-21(16)12-2-9-20-15-3-1-8-19-13-15;;/h1,3,8,13,18,20H,2,4-7,9-12,14H2;2*1H |
| InChIKey | SFFHWQATEWGUFE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|