C16H17NO2 — CID 97130017
2-[[(3R)-3,4-dihydro-2H-chromen-3-yl]methyl]-4-methoxypyridine (PubChem CID 97130017) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is 2-[[(3R)-3,4-dihydro-2H-chromen-3-yl]methyl]-4-methoxypyridine.
| Compound Name | 2-[[(3R)-3,4-dihydro-2H-chromen-3-yl]methyl]-4-methoxypyridine |
|---|---|
| PubChem CID | 97130017 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 2-[[(3R)-3,4-dihydro-2H-chromen-3-yl]methyl]-4-methoxypyridine |
| SMILES | COc1ccnc(C[C@@H]2COc3ccccc3C2)c1 |
| InChI | InChI=1S/C16H17NO2/c1-18-15-6-7-17-14(10-15)9-12-8-13-4-2-3-5-16(13)19-11-12/h2-7,10,12H,8-9,11H2,1H3/t12-/m1/s1 |
| InChIKey | AUICZFGEWMQHSF-GFCCVEGCSA-N |
| XLogP | 2.88 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |