C16H18N2O2 — CID 72938963
6-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]pyridin-2-amine (PubChem CID 72938963) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 6-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]pyridin-2-amine.
| Compound Name | 6-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 72938963 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 6-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]pyridin-2-amine |
| SMILES | COc1ccc2c(c1)OCC(Cc1cccc(N)n1)C2 |
| InChI | InChI=1S/C16H18N2O2/c1-19-14-6-5-12-7-11(10-20-15(12)9-14)8-13-3-2-4-16(17)18-13/h2-6,9,11H,7-8,10H2,1H3,(H2,17,18) |
| InChIKey | GUQVOTMXJHTTMD-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |