C20H23N3O2 — CID 97132449
N-[(1R)-2-methoxy-1-pyridin-2-ylethyl]-N,3,5-trimethyl-1H-indole-2-carboxamide (PubChem CID 97132449) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is N-[(1R)-2-methoxy-1-pyridin-2-ylethyl]-N,3,5-trimethyl-1H-indole-2-carboxamide.
| Compound Name | N-[(1R)-2-methoxy-1-pyridin-2-ylethyl]-N,3,5-trimethyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 97132449 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | N-[(1R)-2-methoxy-1-pyridin-2-ylethyl]-N,3,5-trimethyl-1H-indole-2-carboxamide |
| SMILES | COC[C@@H](c1ccccn1)N(C)C(=O)c1[nH]c2ccc(C)cc2c1C |
| InChI | InChI=1S/C20H23N3O2/c1-13-8-9-16-15(11-13)14(2)19(22-16)20(24)23(3)18(12-25-4)17-7-5-6-10-21-17/h5-11,18,22H,12H2,1-4H3/t18-/m0/s1 |
| InChIKey | SRZCHWLQBAXYDI-SFHVURJKSA-N |
| XLogP | 3.64 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|