C21H25N3O2 — CID 51500846
5-ethoxy-N,3-dimethyl-N-[(2R)-1-pyridin-2-ylpropan-2-yl]-1H-indole-2-carboxamide (PubChem CID 51500846) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 5-ethoxy-N,3-dimethyl-N-[(2R)-1-pyridin-2-ylpropan-2-yl]-1H-indole-2-carboxamide.
| Compound Name | 5-ethoxy-N,3-dimethyl-N-[(2R)-1-pyridin-2-ylpropan-2-yl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 51500846 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 5-ethoxy-N,3-dimethyl-N-[(2R)-1-pyridin-2-ylpropan-2-yl]-1H-indole-2-carboxamide |
| SMILES | CCOc1ccc2[nH]c(C(=O)N(C)[C@H](C)Cc3ccccn3)c(C)c2c1 |
| InChI | InChI=1S/C21H25N3O2/c1-5-26-17-9-10-19-18(13-17)15(3)20(23-19)21(25)24(4)14(2)12-16-8-6-7-11-22-16/h6-11,13-14,23H,5,12H2,1-4H3/t14-/m1/s1 |
| InChIKey | HTAVBFRPBPFTJD-CQSZACIVSA-N |
| XLogP | 3.97 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|