C20H23FN2O2 — CID 97135036
(2S)-2-[4-(3,4-dimethylphenyl)piperazin-1-yl]-2-(3-fluorophenyl)acetic acid (PubChem CID 97135036) has the molecular formula C20H23FN2O2 and a molecular weight of 342.41 g/mol. Its IUPAC name is (2S)-2-[4-(3,4-dimethylphenyl)piperazin-1-yl]-2-(3-fluorophenyl)acetic acid.
| Compound Name | (2S)-2-[4-(3,4-dimethylphenyl)piperazin-1-yl]-2-(3-fluorophenyl)acetic acid |
|---|---|
| PubChem CID | 97135036 |
| Molecular Formula | C20H23FN2O2 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | (2S)-2-[4-(3,4-dimethylphenyl)piperazin-1-yl]-2-(3-fluorophenyl)acetic acid |
| SMILES | Cc1ccc(N2CCN([C@H](C(=O)O)c3cccc(F)c3)CC2)cc1C |
| InChI | InChI=1S/C20H23FN2O2/c1-14-6-7-18(12-15(14)2)22-8-10-23(11-9-22)19(20(24)25)16-4-3-5-17(21)13-16/h3-7,12-13,19H,8-11H2,1-2H3,(H,24,25)/t19-/m0/s1 |
| InChIKey | BNXPVJYZHPBCPB-IBGZPJMESA-N |
| XLogP | 3.39 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|