About N-[(2R)-2-hydroxy-2-[2-(trifluoromethyl)phenyl]ethyl]-2-propyl-1,3-thiazole-4-carboxamide
N-[(2R)-2-hydroxy-2-[2-(trifluoromethyl)phenyl]ethyl]-2-propyl-1,3-thiazole-4-carboxamide (PubChem CID 97136781) has the molecular formula C16H17F3N2O2S
and a molecular weight of 358.39 g/mol. Its IUPAC name is N-[(2R)-2-hydroxy-2-[2-(trifluoromethyl)phenyl]ethyl]-2-propyl-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | N-[(2R)-2-hydroxy-2-[2-(trifluoromethyl)phenyl]ethyl]-2-propyl-1,3-thiazole-4-carboxamide |
| PubChem CID | 97136781 |
| Molecular Formula | C16H17F3N2O2S |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | N-[(2R)-2-hydroxy-2-[2-(trifluoromethyl)phenyl]ethyl]-2-propyl-1,3-thiazole-4-carboxamide |
| SMILES | CCCc1nc(C(=O)NC[C@H](O)c2ccccc2C(F)(F)F)cs1 |
| InChI | InChI=1S/C16H17F3N2O2S/c1-2-5-14-21-12(9-24-14)15(23)20-8-13(22)10-6-3-4-7-11(10)16(17,18)19/h3-4,6-7,9,13,22H,2,5,8H2,1H3,(H,20,23)/t13-/m0/s1 |
| InChIKey | APWSWHVAJWETAZ-ZDUSSCGKSA-N |
| XLogP | 3.58 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(2R)-2-hydroxy-2-[2-(trifluoromethyl)phenyl]ethyl]-2-propyl-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2R)-2-hydroxy-2-[2-(trifluoromethyl)phenyl]ethyl]-2-propyl-1,3-thiazole-4-carboxamide?
The IUPAC name of N-[(2R)-2-hydroxy-2-[2-(trifluoromethyl)phenyl]ethyl]-2-propyl-1,3-thiazole-4-carboxamide (CID 97136781) is N-[(2R)-2-hydroxy-2-[2-(trifluoromethyl)phenyl]ethyl]-2-propyl-1,3-thiazole-4-carboxamide.
What is the SMILES notation for N-[(2R)-2-hydroxy-2-[2-(trifluoromethyl)phenyl]ethyl]-2-propyl-1,3-thiazole-4-carboxamide?
The canonical SMILES for N-[(2R)-2-hydroxy-2-[2-(trifluoromethyl)phenyl]ethyl]-2-propyl-1,3-thiazole-4-carboxamide is CCCc1nc(C(=O)NC[C@H](O)c2ccccc2C(F)(F)F)cs1.
What is the InChIKey of N-[(2R)-2-hydroxy-2-[2-(trifluoromethyl)phenyl]ethyl]-2-propyl-1,3-thiazole-4-carboxamide?
The InChIKey is APWSWHVAJWETAZ-ZDUSSCGKSA-N. The full InChI is InChI=1S/C16H17F3N2O2S/c1-2-5-14-21-12(9-24-14)15(23)20-8-13(22)10-6-3-4-7-11(10)16(17,18)19/h3-4,6-7,9,13,22H,2,5,8H2,1H3,(H,20,23)/t13-/m0/s1.
What are the key properties of N-[(2R)-2-hydroxy-2-[2-(trifluoromethyl)phenyl]ethyl]-2-propyl-1,3-thiazole-4-carboxamide?
N-[(2R)-2-hydroxy-2-[2-(trifluoromethyl)phenyl]ethyl]-2-propyl-1,3-thiazole-4-carboxamide has a molecular weight of 358.39 g/mol, XLogP of 3.58, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2R)-2-hydroxy-2-[2-(trifluoromethyl)phenyl]ethyl]-2-propyl-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 97136781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).