C15H21ClN4O2 — CID 97136827
(3R)-N-[2-(4-chloropyrazol-1-yl)ethyl]-1-cyclopentyl-5-oxopyrrolidine-3-carboxamide (PubChem CID 97136827) has the molecular formula C15H21ClN4O2 and a molecular weight of 324.81 g/mol. Its IUPAC name is (3R)-N-[2-(4-chloropyrazol-1-yl)ethyl]-1-cyclopentyl-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-[2-(4-chloropyrazol-1-yl)ethyl]-1-cyclopentyl-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 97136827 |
| Molecular Formula | C15H21ClN4O2 |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | (3R)-N-[2-(4-chloropyrazol-1-yl)ethyl]-1-cyclopentyl-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(NCCn1cc(Cl)cn1)[C@@H]1CC(=O)N(C2CCCC2)C1 |
| InChI | InChI=1S/C15H21ClN4O2/c16-12-8-18-19(10-12)6-5-17-15(22)11-7-14(21)20(9-11)13-3-1-2-4-13/h8,10-11,13H,1-7,9H2,(H,17,22)/t11-/m1/s1 |
| InChIKey | CIMOINMWBYEHJB-LLVKDONJSA-N |
| XLogP | 1.44 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |