C15H19N7O2S — CID 97141011
(3S)-N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]-5-oxo-1-(pyridin-2-ylmethyl)pyrrolidine-3-carboxamide (PubChem CID 97141011) has the molecular formula C15H19N7O2S and a molecular weight of 361.43 g/mol. Its IUPAC name is (3S)-N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]-5-oxo-1-(pyridin-2-ylmethyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]-5-oxo-1-(pyridin-2-ylmethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 97141011 |
| Molecular Formula | C15H19N7O2S |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | (3S)-N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]-5-oxo-1-(pyridin-2-ylmethyl)pyrrolidine-3-carboxamide |
| SMILES | Cn1nnnc1SCCNC(=O)[C@H]1CC(=O)N(Cc2ccccn2)C1 |
| InChI | InChI=1S/C15H19N7O2S/c1-21-15(18-19-20-21)25-7-6-17-14(24)11-8-13(23)22(9-11)10-12-4-2-3-5-16-12/h2-5,11H,6-10H2,1H3,(H,17,24)/t11-/m0/s1 |
| InChIKey | MWHJUBOYORRDHD-NSHDSACASA-N |
| XLogP | -0.14 |
| TPSA | 105.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|