C16H21NO3S — CID 97146289
(3R)-3-(cyclopropylmethyl)-1-(5-methylthiophene-3-carbonyl)piperidine-3-carboxylic acid (PubChem CID 97146289) has the molecular formula C16H21NO3S and a molecular weight of 307.41 g/mol. Its IUPAC name is (3R)-3-(cyclopropylmethyl)-1-(5-methylthiophene-3-carbonyl)piperidine-3-carboxylic acid.
| Compound Name | (3R)-3-(cyclopropylmethyl)-1-(5-methylthiophene-3-carbonyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 97146289 |
| Molecular Formula | C16H21NO3S |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | (3R)-3-(cyclopropylmethyl)-1-(5-methylthiophene-3-carbonyl)piperidine-3-carboxylic acid |
| SMILES | Cc1cc(C(=O)N2CCC[C@](CC3CC3)(C(=O)O)C2)cs1 |
| InChI | InChI=1S/C16H21NO3S/c1-11-7-13(9-21-11)14(18)17-6-2-5-16(10-17,15(19)20)8-12-3-4-12/h7,9,12H,2-6,8,10H2,1H3,(H,19,20)/t16-/m1/s1 |
| InChIKey | ZMOARPXHFGQINU-MRXNPFEDSA-N |
| XLogP | 3.16 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |